C22H32N4O4 — CID 45212737
methyl 1-[2-hydroxy-3-[4-[[2-(1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propyl]piperidine-4-carboxylate (PubChem CID 45212737) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is methyl 1-[2-hydroxy-3-[4-[[2-(1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-hydroxy-3-[4-[[2-(1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 45212737 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | methyl 1-[2-hydroxy-3-[4-[[2-(1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(CC(O)COc2ccc(CNCCc3cn[nH]c3)cc2)CC1 |
| InChI | InChI=1S/C22H32N4O4/c1-29-22(28)19-7-10-26(11-8-19)15-20(27)16-30-21-4-2-17(3-5-21)12-23-9-6-18-13-24-25-14-18/h2-5,13-14,19-20,23,27H,6-12,15-16H2,1H3,(H,24,25) |
| InChIKey | BRLAGPWZAIKJOO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|