C18H30N2O2S — CID 42241832
(2S)-1-[4-[(2-methylsulfanylethylamino)methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol (PubChem CID 42241832) has the molecular formula C18H30N2O2S and a molecular weight of 338.52 g/mol. Its IUPAC name is (2S)-1-[4-[(2-methylsulfanylethylamino)methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol.
| Compound Name | (2S)-1-[4-[(2-methylsulfanylethylamino)methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 42241832 |
| Molecular Formula | C18H30N2O2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (2S)-1-[4-[(2-methylsulfanylethylamino)methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol |
| SMILES | CSCCNCc1ccc(OC[C@@H](O)CN2CCCCC2)cc1 |
| InChI | InChI=1S/C18H30N2O2S/c1-23-12-9-19-13-16-5-7-18(8-6-16)22-15-17(21)14-20-10-3-2-4-11-20/h5-8,17,19,21H,2-4,9-15H2,1H3/t17-/m0/s1 |
| InChIKey | BFGNTSBRBJCAOR-KRWDZBQOSA-N |
| XLogP | 2.36 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|