C25H40N2O4 — CID 70785884
methyl 1-[3-[3-[(3-cyclopentylpropylamino)methyl]phenoxy]-2-hydroxypropyl]piperidine-4-carboxylate (PubChem CID 70785884) has the molecular formula C25H40N2O4 and a molecular weight of 432.61 g/mol. Its IUPAC name is methyl 1-[3-[3-[(3-cyclopentylpropylamino)methyl]phenoxy]-2-hydroxypropyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[3-[3-[(3-cyclopentylpropylamino)methyl]phenoxy]-2-hydroxypropyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 70785884 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | methyl 1-[3-[3-[(3-cyclopentylpropylamino)methyl]phenoxy]-2-hydroxypropyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(CC(O)COc2cccc(CNCCCC3CCCC3)c2)CC1 |
| InChI | InChI=1S/C25H40N2O4/c1-30-25(29)22-11-14-27(15-12-22)18-23(28)19-31-24-10-4-8-21(16-24)17-26-13-5-9-20-6-2-3-7-20/h4,8,10,16,20,22-23,26,28H,2-3,5-7,9,11-15,17-19H2,1H3 |
| InChIKey | WCYYHVJPVVLJCY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|