C21H36N2O4 — CID 42513203
1-[(2S)-2-hydroxy-3-[3-[(3-propan-2-yloxypropylamino)methyl]phenoxy]propyl]piperidin-4-ol (PubChem CID 42513203) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-3-[3-[(3-propan-2-yloxypropylamino)methyl]phenoxy]propyl]piperidin-4-ol.
| Compound Name | 1-[(2S)-2-hydroxy-3-[3-[(3-propan-2-yloxypropylamino)methyl]phenoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 42513203 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 1-[(2S)-2-hydroxy-3-[3-[(3-propan-2-yloxypropylamino)methyl]phenoxy]propyl]piperidin-4-ol |
| SMILES | CC(C)OCCCNCc1cccc(OC[C@@H](O)CN2CCC(O)CC2)c1 |
| InChI | InChI=1S/C21H36N2O4/c1-17(2)26-12-4-9-22-14-18-5-3-6-21(13-18)27-16-20(25)15-23-10-7-19(24)8-11-23/h3,5-6,13,17,19-20,22,24-25H,4,7-12,14-16H2,1-2H3/t20-/m0/s1 |
| InChIKey | ZURCDZNFBAJTMT-FQEVSTJZSA-N |
| XLogP | 1.79 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|