C23H31ClN2O2 — CID 25458832
(2S)-1-(azepan-1-yl)-3-[3-[[(3-chlorophenyl)methylamino]methyl]phenoxy]propan-2-ol (PubChem CID 25458832) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is (2S)-1-(azepan-1-yl)-3-[3-[[(3-chlorophenyl)methylamino]methyl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-(azepan-1-yl)-3-[3-[[(3-chlorophenyl)methylamino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 25458832 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (2S)-1-(azepan-1-yl)-3-[3-[[(3-chlorophenyl)methylamino]methyl]phenoxy]propan-2-ol |
| SMILES | O[C@H](COc1cccc(CNCc2cccc(Cl)c2)c1)CN1CCCCCC1 |
| InChI | InChI=1S/C23H31ClN2O2/c24-21-9-5-7-19(13-21)15-25-16-20-8-6-10-23(14-20)28-18-22(27)17-26-11-3-1-2-4-12-26/h5-10,13-14,22,25,27H,1-4,11-12,15-18H2/t22-/m0/s1 |
| InChIKey | GPUSANHPLAYCOC-QFIPXVFZSA-N |
| XLogP | 4.25 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |