C22H37N3O3 — CID 45188341
4-[[3-[3-(4-ethylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]methylamino]cyclohexan-1-ol (PubChem CID 45188341) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is 4-[[3-[3-(4-ethylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]methylamino]cyclohexan-1-ol.
| Compound Name | 4-[[3-[3-(4-ethylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 45188341 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 4-[[3-[3-(4-ethylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]methylamino]cyclohexan-1-ol |
| SMILES | CCN1CCN(CC(O)COc2cccc(CNC3CCC(O)CC3)c2)CC1 |
| InChI | InChI=1S/C22H37N3O3/c1-2-24-10-12-25(13-11-24)16-21(27)17-28-22-5-3-4-18(14-22)15-23-19-6-8-20(26)9-7-19/h3-5,14,19-21,23,26-27H,2,6-13,15-17H2,1H3 |
| InChIKey | SKGJIQBBSMPRRP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |