C23H38N4O3 — CID 45175842
1-[2-[[3-[3-(4-ethylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]methylamino]ethyl]piperidin-2-one (PubChem CID 45175842) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is 1-[2-[[3-[3-(4-ethylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]methylamino]ethyl]piperidin-2-one.
| Compound Name | 1-[2-[[3-[3-(4-ethylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]methylamino]ethyl]piperidin-2-one |
|---|---|
| PubChem CID | 45175842 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 1-[2-[[3-[3-(4-ethylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]methylamino]ethyl]piperidin-2-one |
| SMILES | CCN1CCN(CC(O)COc2cccc(CNCCN3CCCCC3=O)c2)CC1 |
| InChI | InChI=1S/C23H38N4O3/c1-2-25-12-14-26(15-13-25)18-21(28)19-30-22-7-5-6-20(16-22)17-24-9-11-27-10-4-3-8-23(27)29/h5-7,16,21,24,28H,2-4,8-15,17-19H2,1H3 |
| InChIKey | WYPISUMKDNEBMU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|