C21H36N2O5 — CID 45250857
1-[2-hydroxy-3-[4-methoxy-2-[(2-propan-2-yloxyethylamino)methyl]phenoxy]propyl]piperidin-4-ol (PubChem CID 45250857) has the molecular formula C21H36N2O5 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-[2-hydroxy-3-[4-methoxy-2-[(2-propan-2-yloxyethylamino)methyl]phenoxy]propyl]piperidin-4-ol.
| Compound Name | 1-[2-hydroxy-3-[4-methoxy-2-[(2-propan-2-yloxyethylamino)methyl]phenoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 45250857 |
| Molecular Formula | C21H36N2O5 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 1-[2-hydroxy-3-[4-methoxy-2-[(2-propan-2-yloxyethylamino)methyl]phenoxy]propyl]piperidin-4-ol |
| SMILES | COc1ccc(OCC(O)CN2CCC(O)CC2)c(CNCCOC(C)C)c1 |
| InChI | InChI=1S/C21H36N2O5/c1-16(2)27-11-8-22-13-17-12-20(26-3)4-5-21(17)28-15-19(25)14-23-9-6-18(24)7-10-23/h4-5,12,16,18-19,22,24-25H,6-11,13-15H2,1-3H3 |
| InChIKey | MMHZRTHNSRJSQT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|