C21H34N2O4 — CID 42525570
1-[(2R)-2-hydroxy-3-[4-methoxy-2-[[methyl(2-methylprop-2-enyl)amino]methyl]phenoxy]propyl]piperidin-4-ol (PubChem CID 42525570) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-[4-methoxy-2-[[methyl(2-methylprop-2-enyl)amino]methyl]phenoxy]propyl]piperidin-4-ol.
| Compound Name | 1-[(2R)-2-hydroxy-3-[4-methoxy-2-[[methyl(2-methylprop-2-enyl)amino]methyl]phenoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 42525570 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-[4-methoxy-2-[[methyl(2-methylprop-2-enyl)amino]methyl]phenoxy]propyl]piperidin-4-ol |
| SMILES | C=C(C)CN(C)Cc1cc(OC)ccc1OC[C@H](O)CN1CCC(O)CC1 |
| InChI | InChI=1S/C21H34N2O4/c1-16(2)12-22(3)13-17-11-20(26-4)5-6-21(17)27-15-19(25)14-23-9-7-18(24)8-10-23/h5-6,11,18-19,24-25H,1,7-10,12-15H2,2-4H3/t19-/m1/s1 |
| InChIKey | XDSJSKYSXHRABU-LJQANCHMSA-N |
| XLogP | 1.90 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|