C25H38N2O4 — CID 25386401
1-[(2R)-3-[2-[[cyclohexyl(prop-2-ynyl)amino]methyl]-4-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol (PubChem CID 25386401) has the molecular formula C25H38N2O4 and a molecular weight of 430.59 g/mol. Its IUPAC name is 1-[(2R)-3-[2-[[cyclohexyl(prop-2-ynyl)amino]methyl]-4-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol.
| Compound Name | 1-[(2R)-3-[2-[[cyclohexyl(prop-2-ynyl)amino]methyl]-4-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
|---|---|
| PubChem CID | 25386401 |
| Molecular Formula | C25H38N2O4 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 1-[(2R)-3-[2-[[cyclohexyl(prop-2-ynyl)amino]methyl]-4-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
| SMILES | C#CCN(Cc1cc(OC)ccc1OC[C@H](O)CN1CCC(O)CC1)C1CCCCC1 |
| InChI | InChI=1S/C25H38N2O4/c1-3-13-27(21-7-5-4-6-8-21)17-20-16-24(30-2)9-10-25(20)31-19-23(29)18-26-14-11-22(28)12-15-26/h1,9-10,16,21-23,28-29H,4-8,11-15,17-19H2,2H3/t23-/m1/s1 |
| InChIKey | LRRMNWZJTPEIEC-HSZRJFAPSA-N |
| XLogP | 2.66 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|