C25H40N4O3 — CID 25292162
(2S)-1-(azocan-1-yl)-3-[5-[[2-(3,5-dimethylpyrazol-1-yl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol (PubChem CID 25292162) has the molecular formula C25H40N4O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is (2S)-1-(azocan-1-yl)-3-[5-[[2-(3,5-dimethylpyrazol-1-yl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol.
| Compound Name | (2S)-1-(azocan-1-yl)-3-[5-[[2-(3,5-dimethylpyrazol-1-yl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 25292162 |
| Molecular Formula | C25H40N4O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (2S)-1-(azocan-1-yl)-3-[5-[[2-(3,5-dimethylpyrazol-1-yl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
| SMILES | COc1ccc(CNCCn2nc(C)cc2C)cc1OC[C@@H](O)CN1CCCCCCC1 |
| InChI | InChI=1S/C25H40N4O3/c1-20-15-21(2)29(27-20)14-11-26-17-22-9-10-24(31-3)25(16-22)32-19-23(30)18-28-12-7-5-4-6-8-13-28/h9-10,15-16,23,26,30H,4-8,11-14,17-19H2,1-3H3/t23-/m0/s1 |
| InChIKey | WRDNFIDZLHJRPK-QHCPKHFHSA-N |
| XLogP | 3.30 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|