C23H36N2O3 — CID 97274933
(2R)-1-[2-(6-oxa-9-azaspiro[4.5]decan-9-ylmethyl)phenoxy]-3-piperidin-1-ylpropan-2-ol (PubChem CID 97274933) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is (2R)-1-[2-(6-oxa-9-azaspiro[4.5]decan-9-ylmethyl)phenoxy]-3-piperidin-1-ylpropan-2-ol.
| Compound Name | (2R)-1-[2-(6-oxa-9-azaspiro[4.5]decan-9-ylmethyl)phenoxy]-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 97274933 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | (2R)-1-[2-(6-oxa-9-azaspiro[4.5]decan-9-ylmethyl)phenoxy]-3-piperidin-1-ylpropan-2-ol |
| SMILES | O[C@@H](COc1ccccc1CN1CCOC2(CCCC2)C1)CN1CCCCC1 |
| InChI | InChI=1S/C23H36N2O3/c26-21(17-24-12-6-1-7-13-24)18-27-22-9-3-2-8-20(22)16-25-14-15-28-23(19-25)10-4-5-11-23/h2-3,8-9,21,26H,1,4-7,10-19H2/t21-/m1/s1 |
| InChIKey | UNQFDXGNAXOPOW-OAQYLSRUSA-N |
| XLogP | 3.06 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |