C22H36N4O3 — CID 29218545
3-[4-[[2-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]phenyl]methyl]piperazin-1-yl]propanamide (PubChem CID 29218545) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is 3-[4-[[2-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]phenyl]methyl]piperazin-1-yl]propanamide.
| Compound Name | 3-[4-[[2-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]phenyl]methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 29218545 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 3-[4-[[2-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]phenyl]methyl]piperazin-1-yl]propanamide |
| SMILES | NC(=O)CCN1CCN(Cc2ccccc2OC[C@H](O)CN2CCCCC2)CC1 |
| InChI | InChI=1S/C22H36N4O3/c23-22(28)8-11-24-12-14-26(15-13-24)16-19-6-2-3-7-21(19)29-18-20(27)17-25-9-4-1-5-10-25/h2-3,6-7,20,27H,1,4-5,8-18H2,(H2,23,28)/t20-/m1/s1 |
| InChIKey | AIGRAIKRVLNVFL-HXUWFJFHSA-N |
| XLogP | 0.91 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |