C23H28ClN3O4 — CID 167186105
1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-(triazol-1-yl)propan-2-ol (PubChem CID 167186105) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is 1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-(triazol-1-yl)propan-2-ol.
| Compound Name | 1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-(triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 167186105 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-3-(triazol-1-yl)propan-2-ol |
| SMILES | CC(C)(c1ccc(OCC(O)CCl)cc1)c1ccc(OCC(O)Cn2ccnn2)cc1 |
| InChI | InChI=1S/C23H28ClN3O4/c1-23(2,17-3-7-21(8-4-17)30-15-19(28)13-24)18-5-9-22(10-6-18)31-16-20(29)14-27-12-11-25-26-27/h3-12,19-20,28-29H,13-16H2,1-2H3 |
| InChIKey | HMJSNBUXCGBARM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|