About 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate
3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate (PubChem CID 175108341) has the molecular formula C16H19FO4
and a molecular weight of 294.32 g/mol. Its IUPAC name is 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate |
| PubChem CID | 175108341 |
| Molecular Formula | C16H19FO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate |
| SMILES | CCC(F)CCOC(=O)/C=C/c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C16H19FO4/c1-3-14(17)10-11-20-16(19)9-6-13-4-7-15(8-5-13)21-12(2)18/h4-9,14H,3,10-11H2,1-2H3/b9-6+ |
| InChIKey | QGQVBLMOXJDTSF-RMKNXTFCSA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate?
The IUPAC name of 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate (CID 175108341) is 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate.
What is the SMILES notation for 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate?
The canonical SMILES for 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate is CCC(F)CCOC(=O)/C=C/c1ccc(OC(C)=O)cc1.
What is the InChIKey of 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate?
The InChIKey is QGQVBLMOXJDTSF-RMKNXTFCSA-N. The full InChI is InChI=1S/C16H19FO4/c1-3-14(17)10-11-20-16(19)9-6-13-4-7-15(8-5-13)21-12(2)18/h4-9,14H,3,10-11H2,1-2H3/b9-6+.
What are the key properties of 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate?
3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate has a molecular weight of 294.32 g/mol, XLogP of 3.31, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropentyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate is sourced from PubChem (CID 175108341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).