C27H42O4 — CID 135188325
(3-hydroxy-5-propan-2-yloxyphenyl) (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 135188325) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is (3-hydroxy-5-propan-2-yloxyphenyl) (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | (3-hydroxy-5-propan-2-yloxyphenyl) (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 135188325 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | (3-hydroxy-5-propan-2-yloxyphenyl) (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)Oc1cc(O)cc(OC(C)C)c1 |
| InChI | InChI=1S/C27H42O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-27(29)31-26-21-24(28)20-25(22-26)30-23(2)3/h8-9,11-12,20-23,28H,4-7,10,13-19H2,1-3H3/b9-8-,12-11- |
| InChIKey | WHPBYWAUEYBCAF-MURFETPASA-N |
| XLogP | 7.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|