C18H21NO — CID 78937787
(1R)-1-[2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)phenyl]ethanamine (PubChem CID 78937787) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (1R)-1-[2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 78937787 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (1R)-1-[2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccccc1OC1CCCc2ccccc21 |
| InChI | InChI=1S/C18H21NO/c1-13(19)15-9-4-5-11-17(15)20-18-12-6-8-14-7-2-3-10-16(14)18/h2-5,7,9-11,13,18H,6,8,12,19H2,1H3/t13-,18?/m1/s1 |
| InChIKey | ZBHUPQFLPNAYIW-YJJYDOSJSA-N |
| XLogP | 4.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |