C16H25N5 — CID 66924197
azane;5-cyclooctylquinazoline-2,4-diamine (PubChem CID 66924197) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is azane;5-cyclooctylquinazoline-2,4-diamine.
| Compound Name | azane;5-cyclooctylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 66924197 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | azane;5-cyclooctylquinazoline-2,4-diamine |
| SMILES | N.Nc1nc(N)c2c(C3CCCCCCC3)cccc2n1 |
| InChI | InChI=1S/C16H22N4.H3N/c17-15-14-12(11-7-4-2-1-3-5-8-11)9-6-10-13(14)19-16(18)20-15;/h6,9-11H,1-5,7-8H2,(H4,17,18,19,20);1H3 |
| InChIKey | QWBNYMKSZJYDBM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |