C38H49NO2S — CID 136669356
2-(1-adamantyl)-6-[2-[[3-(1-adamantyl)-2-hydroxy-5-methylphenyl]methylideneamino]ethylsulfanylmethyl]-4-methylphenol (PubChem CID 136669356) has the molecular formula C38H49NO2S and a molecular weight of 583.88 g/mol. Its IUPAC name is 2-(1-adamantyl)-6-[2-[[3-(1-adamantyl)-2-hydroxy-5-methylphenyl]methylideneamino]ethylsulfanylmethyl]-4-methylphenol.
| Compound Name | 2-(1-adamantyl)-6-[2-[[3-(1-adamantyl)-2-hydroxy-5-methylphenyl]methylideneamino]ethylsulfanylmethyl]-4-methylphenol |
|---|---|
| PubChem CID | 136669356 |
| Molecular Formula | C38H49NO2S |
| Molecular Weight | 583.88 g/mol |
| Exact Mass | 583.35 |
| IUPAC Name | 2-(1-adamantyl)-6-[2-[[3-(1-adamantyl)-2-hydroxy-5-methylphenyl]methylideneamino]ethylsulfanylmethyl]-4-methylphenol |
| SMILES | Cc1cc(/C=N/CCSCc2cc(C)cc(C34CC5CC(CC(C5)C3)C4)c2O)c(O)c(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C38H49NO2S/c1-23-5-31(35(40)33(7-23)37-15-25-9-26(16-37)11-27(10-25)17-37)21-39-3-4-42-22-32-6-24(2)8-34(36(32)41)38-18-28-12-29(19-38)14-30(13-28)20-38/h5-8,21,25-30,40-41H,3-4,9-20,22H2,1-2H3/b39-21+ |
| InChIKey | ACPARQYLIOUJOL-LALXJTNGSA-N |
| XLogP | 9.00 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.88 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|