C21H26N2O4 — CID 136726824
2-[3-[(2-hydroxy-3-methoxy-5-methylphenyl)methylideneamino]propyliminomethyl]-6-methoxy-4-methylphenol (PubChem CID 136726824) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[3-[(2-hydroxy-3-methoxy-5-methylphenyl)methylideneamino]propyliminomethyl]-6-methoxy-4-methylphenol.
| Compound Name | 2-[3-[(2-hydroxy-3-methoxy-5-methylphenyl)methylideneamino]propyliminomethyl]-6-methoxy-4-methylphenol |
|---|---|
| PubChem CID | 136726824 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[3-[(2-hydroxy-3-methoxy-5-methylphenyl)methylideneamino]propyliminomethyl]-6-methoxy-4-methylphenol |
| SMILES | COc1cc(C)cc(/C=N/CCC/N=C/c2cc(C)cc(OC)c2O)c1O |
| InChI | InChI=1S/C21H26N2O4/c1-14-8-16(20(24)18(10-14)26-3)12-22-6-5-7-23-13-17-9-15(2)11-19(27-4)21(17)25/h8-13,24-25H,5-7H2,1-4H3/b22-12+,23-13+ |
| InChIKey | PHVRQHSKWUQANV-FWSOMWAYSA-N |
| XLogP | 3.66 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|