C33H44N2O3S — CID 136786532
(2S)-N-benzhydryl-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-methylbutane-1-sulfonamide (PubChem CID 136786532) has the molecular formula C33H44N2O3S and a molecular weight of 548.79 g/mol. Its IUPAC name is (2S)-N-benzhydryl-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-methylbutane-1-sulfonamide.
| Compound Name | (2S)-N-benzhydryl-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 136786532 |
| Molecular Formula | C33H44N2O3S |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | (2S)-N-benzhydryl-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-methylbutane-1-sulfonamide |
| SMILES | CC(C)[C@@H](CS(=O)(=O)NC(c1ccccc1)c1ccccc1)/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C33H44N2O3S/c1-23(2)29(34-21-26-19-27(32(3,4)5)20-28(31(26)36)33(6,7)8)22-39(37,38)35-30(24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-21,23,29-30,35-36H,22H2,1-8H3/b34-21+/t29-/m1/s1 |
| InChIKey | UHBNKOMNMWUILB-KHIJKKSWSA-N |
| XLogP | 7.14 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|