C36H38F6MnN4O6P- — CID 139264646
2-tert-butyl-6-[[2-[(3-tert-butyl-2-hydroxy-5-nitrophenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-4-nitrophenol;manganese;hexafluorophosphate (PubChem CID 139264646) has the molecular formula C36H38F6MnN4O6P- and a molecular weight of 822.62 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2-[(3-tert-butyl-2-hydroxy-5-nitrophenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-4-nitrophenol;manganese;hexafluorophosphate.
| Compound Name | 2-tert-butyl-6-[[2-[(3-tert-butyl-2-hydroxy-5-nitrophenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-4-nitrophenol;manganese;hexafluorophosphate |
|---|---|
| PubChem CID | 139264646 |
| Molecular Formula | C36H38F6MnN4O6P- |
| Molecular Weight | 822.62 g/mol |
| Exact Mass | 822.18 |
| IUPAC Name | 2-tert-butyl-6-[[2-[(3-tert-butyl-2-hydroxy-5-nitrophenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]-4-nitrophenol;manganese;hexafluorophosphate |
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])cc(/C=N/C(c2ccccc2)C(/N=C/c2cc([N+](=O)[O-])cc(C(C)(C)C)c2O)c2ccccc2)c1O.F[P-](F)(F)(F)(F)F.[Mn] |
| InChI | InChI=1S/C36H38N4O6.F6P.Mn/c1-35(2,3)29-19-27(39(43)44)17-25(33(29)41)21-37-31(23-13-9-7-10-14-23)32(24-15-11-8-12-16-24)38-22-26-18-28(40(45)46)20-30(34(26)42)36(4,5)6;1-7(2,3,4,5)6;/h7-22,31-32,41-42H,1-6H3;;/q;-1;/b37-21+,38-22+;; |
| InChIKey | ZZDCKVMWYLSENW-XIDIDSRISA-N |
| XLogP | 11.91 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.62 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|