C23H30N2O3 — CID 136591637
2,4-ditert-butyl-6-[(2,6-dimethyl-4-nitrophenyl)iminomethyl]phenol (PubChem CID 136591637) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2,6-dimethyl-4-nitrophenyl)iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(2,6-dimethyl-4-nitrophenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 136591637 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2,6-dimethyl-4-nitrophenyl)iminomethyl]phenol |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H30N2O3/c1-14-9-18(25(27)28)10-15(2)20(14)24-13-16-11-17(22(3,4)5)12-19(21(16)26)23(6,7)8/h9-13,26H,1-8H3/b24-13+ |
| InChIKey | LQHYWIQPTPBTCQ-ZMOGYAJESA-N |
| XLogP | 6.26 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|