C23H35O5P — CID 91088876
1-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-diethoxyphosphorylpent-1-en-3-one (PubChem CID 91088876) has the molecular formula C23H35O5P and a molecular weight of 422.50 g/mol. Its IUPAC name is 1-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-diethoxyphosphorylpent-1-en-3-one.
| Compound Name | 1-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-diethoxyphosphorylpent-1-en-3-one |
|---|---|
| PubChem CID | 91088876 |
| Molecular Formula | C23H35O5P |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 1-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-diethoxyphosphorylpent-1-en-3-one |
| SMILES | CCOP(=O)(OCC)C(C)C(=O)C=Cc1cc(C(C)(C)C)c(O)c2c1CCCC2 |
| InChI | InChI=1S/C23H35O5P/c1-7-27-29(26,28-8-2)16(3)21(24)14-13-17-15-20(23(4,5)6)22(25)19-12-10-9-11-18(17)19/h13-16,25H,7-12H2,1-6H3 |
| InChIKey | GSGPSOTZXDCFCU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|