C36H46O7P+ — CID 87872058
bis[(E)-4-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-oxobut-3-enoxy]-oxophosphanium (PubChem CID 87872058) has the molecular formula C36H46O7P+ and a molecular weight of 621.73 g/mol. Its IUPAC name is bis[(E)-4-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-oxobut-3-enoxy]-oxophosphanium.
| Compound Name | bis[(E)-4-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-oxobut-3-enoxy]-oxophosphanium |
|---|---|
| PubChem CID | 87872058 |
| Molecular Formula | C36H46O7P+ |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | bis[(E)-4-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-oxobut-3-enoxy]-oxophosphanium |
| SMILES | CC(C)(C)c1cc(/C=C/C(=O)CO[P+](=O)OCC(=O)/C=C/c2cc(C(C)(C)C)c(O)c3c2CCCC3)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C36H45O7P/c1-35(2,3)31-19-23(27-11-7-9-13-29(27)33(31)39)15-17-25(37)21-42-44(41)43-22-26(38)18-16-24-20-32(36(4,5)6)34(40)30-14-10-8-12-28(24)30/h15-20H,7-14,21-22H2,1-6H3,(H-,37,38,39,40)/p+1 |
| InChIKey | NETHXIGBMWUHHX-UHFFFAOYSA-O |
| XLogP | 8.01 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|