C23H33FO2 — CID 154454992
5-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-ethyl-2-fluorohept-4-en-3-one (PubChem CID 154454992) has the molecular formula C23H33FO2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 5-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-ethyl-2-fluorohept-4-en-3-one.
| Compound Name | 5-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-ethyl-2-fluorohept-4-en-3-one |
|---|---|
| PubChem CID | 154454992 |
| Molecular Formula | C23H33FO2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 5-(3-tert-butyl-4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-ethyl-2-fluorohept-4-en-3-one |
| SMILES | CCC(C(=O)C(C)F)=C(CC)c1cc(C(C)(C)C)c(O)c2c1CCCC2 |
| InChI | InChI=1S/C23H33FO2/c1-7-15(16(8-2)21(25)14(3)24)19-13-20(23(4,5)6)22(26)18-12-10-9-11-17(18)19/h13-14,26H,7-12H2,1-6H3 |
| InChIKey | GYLCJBVKYDERKI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|