C16H18F3IO — CID 139920955
2-(iodomethyl)-1-[4-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalen-1-yl]butan-1-one (PubChem CID 139920955) has the molecular formula C16H18F3IO and a molecular weight of 410.22 g/mol. Its IUPAC name is 2-(iodomethyl)-1-[4-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalen-1-yl]butan-1-one.
| Compound Name | 2-(iodomethyl)-1-[4-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalen-1-yl]butan-1-one |
|---|---|
| PubChem CID | 139920955 |
| Molecular Formula | C16H18F3IO |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-(iodomethyl)-1-[4-(trifluoromethyl)-5,6,7,8-tetrahydronaphthalen-1-yl]butan-1-one |
| SMILES | CCC(CI)C(=O)c1ccc(C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C16H18F3IO/c1-2-10(9-20)15(21)13-7-8-14(16(17,18)19)12-6-4-3-5-11(12)13/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | MKHFOLYKEQOCEA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|