C15H27O5P — CID 71601287
(4E,7S)-2-diethoxyphosphoryl-7-hydroxy-6,6-dimethylnona-4,8-dien-3-one (PubChem CID 71601287) has the molecular formula C15H27O5P and a molecular weight of 318.35 g/mol. Its IUPAC name is (4E,7S)-2-diethoxyphosphoryl-7-hydroxy-6,6-dimethylnona-4,8-dien-3-one.
| Compound Name | (4E,7S)-2-diethoxyphosphoryl-7-hydroxy-6,6-dimethylnona-4,8-dien-3-one |
|---|---|
| PubChem CID | 71601287 |
| Molecular Formula | C15H27O5P |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (4E,7S)-2-diethoxyphosphoryl-7-hydroxy-6,6-dimethylnona-4,8-dien-3-one |
| SMILES | C=C[C@H](O)C(C)(C)/C=C/C(=O)C(C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H27O5P/c1-7-14(17)15(5,6)11-10-13(16)12(4)21(18,19-8-2)20-9-3/h7,10-12,14,17H,1,8-9H2,2-6H3/b11-10+/t12?,14-/m0/s1 |
| InChIKey | IBBLHPHMYYPWLG-XYOBDHIQSA-N |
| XLogP | 3.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|