C10H18ClO5P — CID 23421864
(4R)-1-chloro-1-diethoxyphosphoryl-4-hydroxyhex-5-en-2-one (PubChem CID 23421864) has the molecular formula C10H18ClO5P and a molecular weight of 284.68 g/mol. Its IUPAC name is (4R)-1-chloro-1-diethoxyphosphoryl-4-hydroxyhex-5-en-2-one.
| Compound Name | (4R)-1-chloro-1-diethoxyphosphoryl-4-hydroxyhex-5-en-2-one |
|---|---|
| PubChem CID | 23421864 |
| Molecular Formula | C10H18ClO5P |
| Molecular Weight | 284.68 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (4R)-1-chloro-1-diethoxyphosphoryl-4-hydroxyhex-5-en-2-one |
| SMILES | C=C[C@H](O)CC(=O)C(Cl)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H18ClO5P/c1-4-8(12)7-9(13)10(11)17(14,15-5-2)16-6-3/h4,8,10,12H,1,5-7H2,2-3H3/t8-,10?/m0/s1 |
| InChIKey | QEPQTTOEFHMQNG-PEHGTWAWSA-N |
| XLogP | 2.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.68 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|