C16H24ClO7P — CID 23421874
[(1S)-4-chloro-4-diethoxyphosphoryl-1-(furan-2-yl)-3-oxobutyl] butanoate (PubChem CID 23421874) has the molecular formula C16H24ClO7P and a molecular weight of 394.79 g/mol. Its IUPAC name is [(1S)-4-chloro-4-diethoxyphosphoryl-1-(furan-2-yl)-3-oxobutyl] butanoate.
| Compound Name | [(1S)-4-chloro-4-diethoxyphosphoryl-1-(furan-2-yl)-3-oxobutyl] butanoate |
|---|---|
| PubChem CID | 23421874 |
| Molecular Formula | C16H24ClO7P |
| Molecular Weight | 394.79 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [(1S)-4-chloro-4-diethoxyphosphoryl-1-(furan-2-yl)-3-oxobutyl] butanoate |
| SMILES | CCCC(=O)O[C@@H](CC(=O)C(Cl)P(=O)(OCC)OCC)c1ccco1 |
| InChI | InChI=1S/C16H24ClO7P/c1-4-8-15(19)24-14(13-9-7-10-21-13)11-12(18)16(17)25(20,22-5-2)23-6-3/h7,9-10,14,16H,4-6,8,11H2,1-3H3/t14-,16?/m0/s1 |
| InChIKey | FVGYOBAUDSIRRT-LBAUFKAWSA-N |
| XLogP | 4.45 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|