C27H33NO2 — CID 153439943
[(E)-[(E)-4-(3,5-ditert-butylphenyl)but-3-en-2-ylidene]amino] (E)-3-phenylprop-2-enoate (PubChem CID 153439943) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is [(E)-[(E)-4-(3,5-ditert-butylphenyl)but-3-en-2-ylidene]amino] (E)-3-phenylprop-2-enoate.
| Compound Name | [(E)-[(E)-4-(3,5-ditert-butylphenyl)but-3-en-2-ylidene]amino] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 153439943 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | [(E)-[(E)-4-(3,5-ditert-butylphenyl)but-3-en-2-ylidene]amino] (E)-3-phenylprop-2-enoate |
| SMILES | CC(/C=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1)=N\OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C27H33NO2/c1-20(28-30-25(29)16-15-21-11-9-8-10-12-21)13-14-22-17-23(26(2,3)4)19-24(18-22)27(5,6)7/h8-19H,1-7H3/b14-13+,16-15+,28-20+ |
| InChIKey | DGHWCKVFQNJGFC-IQTCYFMASA-N |
| XLogP | 6.93 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|