C20H19NO2 — CID 5406560
trans-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino] (1R,2R)-2-phenylcyclopropane-1-carboxylate (PubChem CID 5406560) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is trans-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino] (1R,2R)-2-phenylcyclopropane-1-carboxylate.
| Compound Name | trans-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino] (1R,2R)-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 5406560 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | trans-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino] (1R,2R)-2-phenylcyclopropane-1-carboxylate |
| SMILES | CC(/C=C/c1ccccc1)=N\OC(=O)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19NO2/c1-15(12-13-16-8-4-2-5-9-16)21-23-20(22)19-14-18(19)17-10-6-3-7-11-17/h2-13,18-19H,14H2,1H3/b13-12+,21-15+/t18-,19+/m0/s1 |
| InChIKey | QGDFTAUHQOJSKP-XSRFIXTBSA-N |
| XLogP | 4.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|