C20H20N2O — CID 129439751
cis-(1R,2S)-2-phenyl-N-[[(Z)-4-phenylbut-3-en-2-ylidene]amino]cyclopropane-1-carboxamide (PubChem CID 129439751) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is cis-(1R,2S)-2-phenyl-N-[[(Z)-4-phenylbut-3-en-2-ylidene]amino]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-phenyl-N-[[(Z)-4-phenylbut-3-en-2-ylidene]amino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129439751 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | cis-(1R,2S)-2-phenyl-N-[[(Z)-4-phenylbut-3-en-2-ylidene]amino]cyclopropane-1-carboxamide |
| SMILES | CC(/C=C\c1ccccc1)=NNC(=O)[C@@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H20N2O/c1-15(12-13-16-8-4-2-5-9-16)21-22-20(23)19-14-18(19)17-10-6-3-7-11-17/h2-13,18-19H,14H2,1H3,(H,22,23)/b13-12-,21-15?/t18-,19-/m1/s1 |
| InChIKey | OFFPXSVZSZHNOC-VVRZWVSASA-N |
| XLogP | 4.00 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|