C22H26N2O2 — CID 7260166
trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-[(E)-4-(furan-2-yl)but-3-en-2-ylidene]amino]cyclopropane-1-carboxamide (PubChem CID 7260166) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-[(E)-4-(furan-2-yl)but-3-en-2-ylidene]amino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-[(E)-4-(furan-2-yl)but-3-en-2-ylidene]amino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7260166 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-[(E)-4-(furan-2-yl)but-3-en-2-ylidene]amino]cyclopropane-1-carboxamide |
| SMILES | CC(/C=C/c1ccco1)=N\NC(=O)[C@@H]1C[C@H]1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-15(7-12-18-6-5-13-26-18)23-24-21(25)20-14-19(20)16-8-10-17(11-9-16)22(2,3)4/h5-13,19-20H,14H2,1-4H3,(H,24,25)/b12-7+,23-15+/t19-,20+/m0/s1 |
| InChIKey | ODDYFEWEQQSEMN-IEZXIDQVSA-N |
| XLogP | 4.89 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|