C11H12O8S — CID 162822304
sulfo 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 162822304) has the molecular formula C11H12O8S and a molecular weight of 304.28 g/mol. Its IUPAC name is sulfo 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | sulfo 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162822304 |
| Molecular Formula | C11H12O8S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | sulfo 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OS(=O)(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C11H12O8S/c1-17-8-5-7(6-9(18-2)11(8)13)3-4-10(12)19-20(14,15)16/h3-6,13H,1-2H3,(H,14,15,16) |
| InChIKey | LAHUBJBDDCZJTK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|