C21H26ClN3O3 — CID 98807950
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]prop-2-enamide (PubChem CID 98807950) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 98807950 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)/C=C/c2cc(Cl)c(OC)c(OC)c2)cn1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-5-25(6-2)19-9-7-16(13-23-19)14-24-20(26)10-8-15-11-17(22)21(28-4)18(12-15)27-3/h7-13H,5-6,14H2,1-4H3,(H,24,26)/b10-8+ |
| InChIKey | KBUTVMRBNHIAGS-CSKARUKUSA-N |
| XLogP | 3.93 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|