C21H28N4O3S — CID 55964932
N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-[4-(ethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 55964932) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-[4-(ethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-[4-(ethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55964932 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-[4-(ethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCNS(=O)(=O)c1ccc(C=CC(=O)NCc2ccc(N(CC)CC)nc2)cc1 |
| InChI | InChI=1S/C21H28N4O3S/c1-4-24-29(27,28)19-11-7-17(8-12-19)10-14-21(26)23-16-18-9-13-20(22-15-18)25(5-2)6-3/h7-15,24H,4-6,16H2,1-3H3,(H,23,26) |
| InChIKey | DMEBBZCETMIFPP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|