C18H22N4O3S — CID 55621168
(E)-N-[[6-(dimethylamino)-3-pyridinyl]methyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 55621168) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is (E)-N-[[6-(dimethylamino)-3-pyridinyl]methyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[[6-(dimethylamino)-3-pyridinyl]methyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55621168 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (E)-N-[[6-(dimethylamino)-3-pyridinyl]methyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1ccc(/C=C/C(=O)NCc2ccc(N(C)C)nc2)cc1 |
| InChI | InChI=1S/C18H22N4O3S/c1-19-26(24,25)16-8-4-14(5-9-16)7-11-18(23)21-13-15-6-10-17(20-12-15)22(2)3/h4-12,19H,13H2,1-3H3,(H,21,23)/b11-7+ |
| InChIKey | RBTYAPLLBHQSCF-YRNVUSSQSA-N |
| XLogP | 1.39 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|