C17H20ClF3N2O — CID 55587289
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(4-propan-2-ylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 55587289) has the molecular formula C17H20ClF3N2O and a molecular weight of 360.81 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(4-propan-2-ylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(4-propan-2-ylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55587289 |
| Molecular Formula | C17H20ClF3N2O |
| Molecular Weight | 360.81 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(4-propan-2-ylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | CC(C)N1CCN(C(=O)/C=C/c2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H20ClF3N2O/c1-12(2)22-7-9-23(10-8-22)16(24)6-4-13-3-5-15(18)14(11-13)17(19,20)21/h3-6,11-12H,7-10H2,1-2H3/b6-4+ |
| InChIKey | QZVNQVBKASQKFX-GQCTYLIASA-N |
| XLogP | 3.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|