C20H21ClN2O4S — CID 46276882
3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-(2-chlorophenyl)butanamide (PubChem CID 46276882) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-(2-chlorophenyl)butanamide.
| Compound Name | 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-(2-chlorophenyl)butanamide |
|---|---|
| PubChem CID | 46276882 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-(2-chlorophenyl)butanamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)C(C)CC(=O)Nc3ccccc3Cl)ccc21 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-13(11-20(25)22-18-6-4-3-5-17(18)21)28(26,27)16-7-8-19-15(12-16)9-10-23(19)14(2)24/h3-8,12-13H,9-11H2,1-2H3,(H,22,25) |
| InChIKey | YYPMAUUJKOPTNJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |