C21H24N2O5S — CID 20914857
3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-(4-methoxyphenyl)butanamide (PubChem CID 20914857) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-(4-methoxyphenyl)butanamide.
| Compound Name | 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 20914857 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(NC(=O)CC(C)S(=O)(=O)c2ccc3c(c2)CCN3C(C)=O)cc1 |
| InChI | InChI=1S/C21H24N2O5S/c1-14(12-21(25)22-17-4-6-18(28-3)7-5-17)29(26,27)19-8-9-20-16(13-19)10-11-23(20)15(2)24/h4-9,13-14H,10-12H2,1-3H3,(H,22,25) |
| InChIKey | PSVJMXVDGQEMPZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |