C17H16N2O2 — CID 108521001
2-(2,3-dihydroindol-1-yl)-N-methyl-2-oxo-N-phenylacetamide (PubChem CID 108521001) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-N-methyl-2-oxo-N-phenylacetamide.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-N-methyl-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 108521001 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-N-methyl-2-oxo-N-phenylacetamide |
| SMILES | CN(C(=O)C(=O)N1CCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c1-18(14-8-3-2-4-9-14)16(20)17(21)19-12-11-13-7-5-6-10-15(13)19/h2-10H,11-12H2,1H3 |
| InChIKey | RYESFLNHBBIBPO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|