C15H23N5O2 — CID 108529126
N-[3-(dimethylamino)phenyl]-N'-(4-methylpiperazin-1-yl)oxamide (PubChem CID 108529126) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[3-(dimethylamino)phenyl]-N'-(4-methylpiperazin-1-yl)oxamide.
| Compound Name | N-[3-(dimethylamino)phenyl]-N'-(4-methylpiperazin-1-yl)oxamide |
|---|---|
| PubChem CID | 108529126 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-[3-(dimethylamino)phenyl]-N'-(4-methylpiperazin-1-yl)oxamide |
| SMILES | CN1CCN(NC(=O)C(=O)Nc2cccc(N(C)C)c2)CC1 |
| InChI | InChI=1S/C15H23N5O2/c1-18(2)13-6-4-5-12(11-13)16-14(21)15(22)17-20-9-7-19(3)8-10-20/h4-6,11H,7-10H2,1-3H3,(H,16,21)(H,17,22) |
| InChIKey | MZXDBDPXXDTYBU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|