C13H15N5O4S — CID 146152519
N'-(1,4-dimethylpyrazol-5-yl)-N-(4-sulfamoylphenyl)oxamide (PubChem CID 146152519) has the molecular formula C13H15N5O4S and a molecular weight of 337.36 g/mol. Its IUPAC name is N'-(1,4-dimethylpyrazol-5-yl)-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-(1,4-dimethylpyrazol-5-yl)-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 146152519 |
| Molecular Formula | C13H15N5O4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N'-(1,4-dimethylpyrazol-5-yl)-N-(4-sulfamoylphenyl)oxamide |
| SMILES | Cc1cnn(C)c1NC(=O)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H15N5O4S/c1-8-7-15-18(2)11(8)17-13(20)12(19)16-9-3-5-10(6-4-9)23(14,21)22/h3-7H,1-2H3,(H,16,19)(H,17,20)(H2,14,21,22) |
| InChIKey | PKYJZQSGYORRHT-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|