C19H17FN4O3S — CID 69206042
(E)-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 69206042) has the molecular formula C19H17FN4O3S and a molecular weight of 400.44 g/mol. Its IUPAC name is (E)-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 69206042 |
| Molecular Formula | C19H17FN4O3S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (E)-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | Cn1ncc(/C=C/C(=O)Nc2ccc(S(N)(=O)=O)cc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN4O3S/c1-24-19(13-2-5-15(20)6-3-13)14(12-22-24)4-11-18(25)23-16-7-9-17(10-8-16)28(21,26)27/h2-12H,1H3,(H,23,25)(H2,21,26,27)/b11-4+ |
| InChIKey | QJTIUIYMXYPKIV-NYYWCZLTSA-N |
| XLogP | 2.53 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|