C25H24FN5O — CID 69208690
(E)-N-[4-[(4-ethylimidazol-1-yl)methyl]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide (PubChem CID 69208690) has the molecular formula C25H24FN5O and a molecular weight of 429.50 g/mol. Its IUPAC name is (E)-N-[4-[(4-ethylimidazol-1-yl)methyl]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[4-[(4-ethylimidazol-1-yl)methyl]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 69208690 |
| Molecular Formula | C25H24FN5O |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (E)-N-[4-[(4-ethylimidazol-1-yl)methyl]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide |
| SMILES | CCc1cn(Cc2ccc(NC(=O)/C=C/c3cnn(C)c3-c3ccc(F)cc3)cc2)cn1 |
| InChI | InChI=1S/C25H24FN5O/c1-3-22-16-31(17-27-22)15-18-4-11-23(12-5-18)29-24(32)13-8-20-14-28-30(2)25(20)19-6-9-21(26)10-7-19/h4-14,16-17H,3,15H2,1-2H3,(H,29,32)/b13-8+ |
| InChIKey | BCKIUBHPMFTMHH-MDWZMJQESA-N |
| XLogP | 4.69 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|