C27H22FN5O — CID 69208874
3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-(indazol-1-ylmethyl)phenyl]prop-2-enamide (PubChem CID 69208874) has the molecular formula C27H22FN5O and a molecular weight of 451.51 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-(indazol-1-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | 3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-(indazol-1-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 69208874 |
| Molecular Formula | C27H22FN5O |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-(indazol-1-ylmethyl)phenyl]prop-2-enamide |
| SMILES | Cn1ncc(C=CC(=O)Nc2ccc(Cn3ncc4ccccc43)cc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H22FN5O/c1-32-27(20-8-11-23(28)12-9-20)22(17-29-32)10-15-26(34)31-24-13-6-19(7-14-24)18-33-25-5-3-2-4-21(25)16-30-33/h2-17H,18H2,1H3,(H,31,34) |
| InChIKey | MTAHNUPPLBODJY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|