C22H20FN7O — CID 69209157
3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-[(2-methyltetrazol-5-yl)methyl]phenyl]prop-2-enamide (PubChem CID 69209157) has the molecular formula C22H20FN7O and a molecular weight of 417.45 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-[(2-methyltetrazol-5-yl)methyl]phenyl]prop-2-enamide.
| Compound Name | 3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-[(2-methyltetrazol-5-yl)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 69209157 |
| Molecular Formula | C22H20FN7O |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-[(2-methyltetrazol-5-yl)methyl]phenyl]prop-2-enamide |
| SMILES | Cn1nnc(Cc2ccc(NC(=O)C=Cc3cnn(C)c3-c3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C22H20FN7O/c1-29-22(16-5-8-18(23)9-6-16)17(14-24-29)7-12-21(31)25-19-10-3-15(4-11-19)13-20-26-28-30(2)27-20/h3-12,14H,13H2,1-2H3,(H,25,31) |
| InChIKey | QQWWAZBMZKVLNC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|