C25H23FN4O3S — CID 173148155
N-[4-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide (PubChem CID 173148155) has the molecular formula C25H23FN4O3S and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[4-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide.
| Compound Name | N-[4-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 173148155 |
| Molecular Formula | C25H23FN4O3S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | N-[4-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide |
| SMILES | CCN1C(=O)SC(Cc2ccc(NC(=O)C=Cc3cnn(C)c3-c3ccc(F)cc3)cc2)C1=O |
| InChI | InChI=1S/C25H23FN4O3S/c1-3-30-24(32)21(34-25(30)33)14-16-4-11-20(12-5-16)28-22(31)13-8-18-15-27-29(2)23(18)17-6-9-19(26)10-7-17/h4-13,15,21H,3,14H2,1-2H3,(H,28,31) |
| InChIKey | RDYIZZUKRRBQSS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|