C25H29FN3O4P — CID 90905866
N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[1-ethyl-5-(4-fluorophenyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 90905866) has the molecular formula C25H29FN3O4P and a molecular weight of 485.50 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[1-ethyl-5-(4-fluorophenyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[1-ethyl-5-(4-fluorophenyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90905866 |
| Molecular Formula | C25H29FN3O4P |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[1-ethyl-5-(4-fluorophenyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)C=Cc2cnn(CC)c2-c2ccc(F)cc2)cc1)OCC |
| InChI | InChI=1S/C25H29FN3O4P/c1-4-29-25(20-9-12-22(26)13-10-20)21(17-27-29)11-16-24(30)28-23-14-7-19(8-15-23)18-34(31,32-5-2)33-6-3/h7-17H,4-6,18H2,1-3H3,(H,28,30) |
| InChIKey | ITPHBHPZTHQNNY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|